C9H12ClFN2 — CID 171203354
(1R)-1-(2-fluoro-3-pyridinyl)but-3-en-1-amine;hydrochloride (PubChem CID 171203354) has the molecular formula C9H12ClFN2 and a molecular weight of 202.66 g/mol. Its IUPAC name is (1R)-1-(2-fluoro-3-pyridinyl)but-3-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2-fluoro-3-pyridinyl)but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171203354 |
| Molecular Formula | C9H12ClFN2 |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (1R)-1-(2-fluoro-3-pyridinyl)but-3-en-1-amine;hydrochloride |
| SMILES | C=CC[C@@H](N)c1cccnc1F.Cl |
| InChI | InChI=1S/C9H11FN2.ClH/c1-2-4-8(11)7-5-3-6-12-9(7)10;/h2-3,5-6,8H,1,4,11H2;1H/t8-;/m1./s1 |
| InChIKey | WTGKMBZUUCIAGV-DDWIOCJRSA-N |
| XLogP | 2.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|