C13H15Cl2F4N — CID 171209273
(R)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-cyclopentylmethanamine;hydrochloride (PubChem CID 171209273) has the molecular formula C13H15Cl2F4N and a molecular weight of 332.17 g/mol. Its IUPAC name is (R)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-cyclopentylmethanamine;hydrochloride.
| Compound Name | (R)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-cyclopentylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171209273 |
| Molecular Formula | C13H15Cl2F4N |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (R)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-cyclopentylmethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1c(C(F)(F)F)ccc(Cl)c1F)C1CCCC1 |
| InChI | InChI=1S/C13H14ClF4N.ClH/c14-9-6-5-8(13(16,17)18)10(11(9)15)12(19)7-3-1-2-4-7;/h5-7,12H,1-4,19H2;1H/t12-;/m1./s1 |
| InChIKey | UNAFLHFVXWZEAY-UTONKHPSSA-N |
| XLogP | 5.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |