C12H14Cl2F3N — CID 171207653
(R)-[4-chloro-3-(trifluoromethyl)phenyl]-cyclobutylmethanamine;hydrochloride (PubChem CID 171207653) has the molecular formula C12H14Cl2F3N and a molecular weight of 300.15 g/mol. Its IUPAC name is (R)-[4-chloro-3-(trifluoromethyl)phenyl]-cyclobutylmethanamine;hydrochloride.
| Compound Name | (R)-[4-chloro-3-(trifluoromethyl)phenyl]-cyclobutylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171207653 |
| Molecular Formula | C12H14Cl2F3N |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (R)-[4-chloro-3-(trifluoromethyl)phenyl]-cyclobutylmethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(Cl)c(C(F)(F)F)c1)C1CCC1 |
| InChI | InChI=1S/C12H13ClF3N.ClH/c13-10-5-4-8(6-9(10)12(14,15)16)11(17)7-2-1-3-7;/h4-7,11H,1-3,17H2;1H/t11-;/m1./s1 |
| InChIKey | SPSFOKBNQHWJFJ-RFVHGSKJSA-N |
| XLogP | 4.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |