C12H17Cl2N — CID 171224005
(S)-(3-chloro-4-methylphenyl)-cyclobutylmethanamine;hydrochloride (PubChem CID 171224005) has the molecular formula C12H17Cl2N and a molecular weight of 246.18 g/mol. Its IUPAC name is (S)-(3-chloro-4-methylphenyl)-cyclobutylmethanamine;hydrochloride.
| Compound Name | (S)-(3-chloro-4-methylphenyl)-cyclobutylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171224005 |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (S)-(3-chloro-4-methylphenyl)-cyclobutylmethanamine;hydrochloride |
| SMILES | Cc1ccc([C@@H](N)C2CCC2)cc1Cl.Cl |
| InChI | InChI=1S/C12H16ClN.ClH/c1-8-5-6-10(7-11(8)13)12(14)9-3-2-4-9;/h5-7,9,12H,2-4,14H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | DLMSMWNXYQQRQF-YDALLXLXSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |