C14H21Cl2N — CID 171204433
(R)-(3-chloro-4-methylphenyl)-cyclohexylmethanamine;hydrochloride (PubChem CID 171204433) has the molecular formula C14H21Cl2N and a molecular weight of 274.24 g/mol. Its IUPAC name is (R)-(3-chloro-4-methylphenyl)-cyclohexylmethanamine;hydrochloride.
| Compound Name | (R)-(3-chloro-4-methylphenyl)-cyclohexylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171204433 |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (R)-(3-chloro-4-methylphenyl)-cyclohexylmethanamine;hydrochloride |
| SMILES | Cc1ccc([C@H](N)C2CCCCC2)cc1Cl.Cl |
| InChI | InChI=1S/C14H20ClN.ClH/c1-10-7-8-12(9-13(10)15)14(16)11-5-3-2-4-6-11;/h7-9,11,14H,2-6,16H2,1H3;1H/t14-;/m1./s1 |
| InChIKey | JYOPJRBSOHMFIR-PFEQFJNWSA-N |
| XLogP | 4.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |