C14H20Cl2FN — CID 171228747
(S)-(6-chloro-2-fluoro-3-methylphenyl)-cyclohexylmethanamine;hydrochloride (PubChem CID 171228747) has the molecular formula C14H20Cl2FN and a molecular weight of 292.22 g/mol. Its IUPAC name is (S)-(6-chloro-2-fluoro-3-methylphenyl)-cyclohexylmethanamine;hydrochloride.
| Compound Name | (S)-(6-chloro-2-fluoro-3-methylphenyl)-cyclohexylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171228747 |
| Molecular Formula | C14H20Cl2FN |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (S)-(6-chloro-2-fluoro-3-methylphenyl)-cyclohexylmethanamine;hydrochloride |
| SMILES | Cc1ccc(Cl)c([C@@H](N)C2CCCCC2)c1F.Cl |
| InChI | InChI=1S/C14H19ClFN.ClH/c1-9-7-8-11(15)12(13(9)16)14(17)10-5-3-2-4-6-10;/h7-8,10,14H,2-6,17H2,1H3;1H/t14-;/m0./s1 |
| InChIKey | FJYATMUSFDYQJZ-UQKRIMTDSA-N |
| XLogP | 4.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |