C13H17ClFN — CID 171209698
(R)-(2-chloro-6-fluoro-3-methylphenyl)-cyclopentylmethanamine (PubChem CID 171209698) has the molecular formula C13H17ClFN and a molecular weight of 241.74 g/mol. Its IUPAC name is (R)-(2-chloro-6-fluoro-3-methylphenyl)-cyclopentylmethanamine.
| Compound Name | (R)-(2-chloro-6-fluoro-3-methylphenyl)-cyclopentylmethanamine |
|---|---|
| PubChem CID | 171209698 |
| Molecular Formula | C13H17ClFN |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (R)-(2-chloro-6-fluoro-3-methylphenyl)-cyclopentylmethanamine |
| SMILES | Cc1ccc(F)c([C@H](N)C2CCCC2)c1Cl |
| InChI | InChI=1S/C13H17ClFN/c1-8-6-7-10(15)11(12(8)14)13(16)9-4-2-3-5-9/h6-7,9,13H,2-5,16H2,1H3/t13-/m1/s1 |
| InChIKey | IQCCRRABDLNZDZ-CYBMUJFWSA-N |
| XLogP | 3.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |