C15H24ClN — CID 171200491
(R)-cyclohexyl-(3,4-dimethylphenyl)methanamine;hydrochloride (PubChem CID 171200491) has the molecular formula C15H24ClN and a molecular weight of 253.82 g/mol. Its IUPAC name is (R)-cyclohexyl-(3,4-dimethylphenyl)methanamine;hydrochloride.
| Compound Name | (R)-cyclohexyl-(3,4-dimethylphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171200491 |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.82 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | (R)-cyclohexyl-(3,4-dimethylphenyl)methanamine;hydrochloride |
| SMILES | Cc1ccc([C@H](N)C2CCCCC2)cc1C.Cl |
| InChI | InChI=1S/C15H23N.ClH/c1-11-8-9-14(10-12(11)2)15(16)13-6-4-3-5-7-13;/h8-10,13,15H,3-7,16H2,1-2H3;1H/t15-;/m1./s1 |
| InChIKey | ONAPRVSRWWLTMM-XFULWGLBSA-N |
| XLogP | 4.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |