C15H21F2N — CID 105140363
(4,4-difluorocyclohexyl)-(3,4-dimethylphenyl)methanamine (PubChem CID 105140363) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(3,4-dimethylphenyl)methanamine.
| Compound Name | (4,4-difluorocyclohexyl)-(3,4-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 105140363 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(3,4-dimethylphenyl)methanamine |
| SMILES | Cc1ccc(C(N)C2CCC(F)(F)CC2)cc1C |
| InChI | InChI=1S/C15H21F2N/c1-10-3-4-13(9-11(10)2)14(18)12-5-7-15(16,17)8-6-12/h3-4,9,12,14H,5-8,18H2,1-2H3 |
| InChIKey | PQYNHWQVNUJAIM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |