C13H20N2 — CID 116935490
(3,4-dimethylphenyl)-pyrrolidin-3-ylmethanamine (PubChem CID 116935490) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-pyrrolidin-3-ylmethanamine.
| Compound Name | (3,4-dimethylphenyl)-pyrrolidin-3-ylmethanamine |
|---|---|
| PubChem CID | 116935490 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (3,4-dimethylphenyl)-pyrrolidin-3-ylmethanamine |
| SMILES | Cc1ccc(C(N)C2CCNC2)cc1C |
| InChI | InChI=1S/C13H20N2/c1-9-3-4-11(7-10(9)2)13(14)12-5-6-15-8-12/h3-4,7,12-13,15H,5-6,8,14H2,1-2H3 |
| InChIKey | QGHITMXLIACRJU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |