C12H16F2N2 — CID 82287810
(3,4-difluorophenyl)-piperidin-4-ylmethanamine (PubChem CID 82287810) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is (3,4-difluorophenyl)-piperidin-4-ylmethanamine.
| Compound Name | (3,4-difluorophenyl)-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 82287810 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (3,4-difluorophenyl)-piperidin-4-ylmethanamine |
| SMILES | NC(c1ccc(F)c(F)c1)C1CCNCC1 |
| InChI | InChI=1S/C12H16F2N2/c13-10-2-1-9(7-11(10)14)12(15)8-3-5-16-6-4-8/h1-2,7-8,12,16H,3-6,15H2 |
| InChIKey | ZHDAWFXEOIAKFX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |