C16H21ClF4N2 — CID 171171510
1-[(1R)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine (PubChem CID 171171510) has the molecular formula C16H21ClF4N2 and a molecular weight of 352.80 g/mol. Its IUPAC name is 1-[(1R)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine.
| Compound Name | 1-[(1R)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171171510 |
| Molecular Formula | C16H21ClF4N2 |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-[(1R)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine |
| SMILES | CC(C)C[C@H](c1c(C(F)(F)F)ccc(Cl)c1F)N1CCNCC1 |
| InChI | InChI=1S/C16H21ClF4N2/c1-10(2)9-13(23-7-5-22-6-8-23)14-11(16(19,20)21)3-4-12(17)15(14)18/h3-4,10,13,22H,5-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | YZWILEHXNJMKRC-CYBMUJFWSA-N |
| XLogP | 4.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |