C17H23ClF4N2 — CID 171171538
1-[(1R)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine (PubChem CID 171171538) has the molecular formula C17H23ClF4N2 and a molecular weight of 366.83 g/mol. Its IUPAC name is 1-[(1R)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine.
| Compound Name | 1-[(1R)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171171538 |
| Molecular Formula | C17H23ClF4N2 |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[(1R)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine |
| SMILES | CCCC(C)[C@H](c1c(C(F)(F)F)ccc(Cl)c1F)N1CCNCC1 |
| InChI | InChI=1S/C17H23ClF4N2/c1-3-4-11(2)16(24-9-7-23-8-10-24)14-12(17(20,21)22)5-6-13(18)15(14)19/h5-6,11,16,23H,3-4,7-10H2,1-2H3/t11?,16-/m1/s1 |
| InChIKey | GCYZRWWPTODMDM-WVQRXBFSSA-N |
| XLogP | 4.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |