C17H25Cl2F3N2 — CID 171166477
1-[(1S)-1-[2-chloro-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine;hydrochloride (PubChem CID 171166477) has the molecular formula C17H25Cl2F3N2 and a molecular weight of 385.30 g/mol. Its IUPAC name is 1-[(1S)-1-[2-chloro-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[2-chloro-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171166477 |
| Molecular Formula | C17H25Cl2F3N2 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[(1S)-1-[2-chloro-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine;hydrochloride |
| SMILES | CCCC(C)[C@@H](c1cc(C(F)(F)F)ccc1Cl)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H24ClF3N2.ClH/c1-3-4-12(2)16(23-9-7-22-8-10-23)14-11-13(17(19,20)21)5-6-15(14)18;/h5-6,11-12,16,22H,3-4,7-10H2,1-2H3;1H/t12?,16-;/m0./s1 |
| InChIKey | WTOVBVJPCNVKDD-LDYGMWQQSA-N |
| XLogP | 5.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |