C13H18Cl3F3N2 — CID 171292767
1-[(1R)-1-[2-chloro-5-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride (PubChem CID 171292767) has the molecular formula C13H18Cl3F3N2 and a molecular weight of 365.65 g/mol. Its IUPAC name is 1-[(1R)-1-[2-chloro-5-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-[2-chloro-5-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171292767 |
| Molecular Formula | C13H18Cl3F3N2 |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 1-[(1R)-1-[2-chloro-5-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride |
| SMILES | C[C@H](c1cc(C(F)(F)F)ccc1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H16ClF3N2.2ClH/c1-9(19-6-4-18-5-7-19)11-8-10(13(15,16)17)2-3-12(11)14;;/h2-3,8-9,18H,4-7H2,1H3;2*1H/t9-;;/m1../s1 |
| InChIKey | DIQZVAHIWMYWPR-KLQYNRQASA-N |
| XLogP | 4.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |