C13H17Cl3F4N2 — CID 171279937
1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride (PubChem CID 171279937) has the molecular formula C13H17Cl3F4N2 and a molecular weight of 383.64 g/mol. Its IUPAC name is 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171279937 |
| Molecular Formula | C13H17Cl3F4N2 |
| Molecular Weight | 383.64 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride |
| SMILES | C[C@@H](c1cc(C(F)(F)F)cc(Cl)c1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H15ClF4N2.2ClH/c1-8(20-4-2-19-3-5-20)10-6-9(13(16,17)18)7-11(14)12(10)15;;/h6-8,19H,2-5H2,1H3;2*1H/t8-;;/m0../s1 |
| InChIKey | RNMWMVMJBVRRMA-JZGIKJSDSA-N |
| XLogP | 4.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |