C13H14ClF5N2 — CID 171182017
1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine (PubChem CID 171182017) has the molecular formula C13H14ClF5N2 and a molecular weight of 328.71 g/mol. Its IUPAC name is 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine.
| Compound Name | 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine |
|---|---|
| PubChem CID | 171182017 |
| Molecular Formula | C13H14ClF5N2 |
| Molecular Weight | 328.71 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-[(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine |
| SMILES | FC[C@H](c1cc(C(F)(F)F)cc(Cl)c1F)N1CCNCC1 |
| InChI | InChI=1S/C13H14ClF5N2/c14-10-6-8(13(17,18)19)5-9(12(10)16)11(7-15)21-3-1-20-2-4-21/h5-6,11,20H,1-4,7H2/t11-/m1/s1 |
| InChIKey | RUKMEQJLMMOPMH-LLVKDONJSA-N |
| XLogP | 3.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.71 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |