C13H15ClF4N2O — CID 171174689
(2R)-2-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-piperazin-1-ylethanol (PubChem CID 171174689) has the molecular formula C13H15ClF4N2O and a molecular weight of 326.72 g/mol. Its IUPAC name is (2R)-2-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-piperazin-1-ylethanol.
| Compound Name | (2R)-2-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 171174689 |
| Molecular Formula | C13H15ClF4N2O |
| Molecular Weight | 326.72 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (2R)-2-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-piperazin-1-ylethanol |
| SMILES | OC[C@@H](c1cc(C(F)(F)F)cc(Cl)c1F)N1CCNCC1 |
| InChI | InChI=1S/C13H15ClF4N2O/c14-10-6-8(13(16,17)18)5-9(12(10)15)11(7-21)20-3-1-19-2-4-20/h5-6,11,19,21H,1-4,7H2/t11-/m0/s1 |
| InChIKey | IUDUFHPWGSDEMU-NSHDSACASA-N |
| XLogP | 2.44 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.72 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |