C16H23Cl2F3N2 — CID 171165364
1-[(1S)-1-[2-chloro-6-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine;hydrochloride (PubChem CID 171165364) has the molecular formula C16H23Cl2F3N2 and a molecular weight of 371.27 g/mol. Its IUPAC name is 1-[(1S)-1-[2-chloro-6-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[2-chloro-6-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171165364 |
| Molecular Formula | C16H23Cl2F3N2 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-[(1S)-1-[2-chloro-6-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine;hydrochloride |
| SMILES | CC(C)C[C@@H](c1c(Cl)cccc1C(F)(F)F)N1CCNCC1.Cl |
| InChI | InChI=1S/C16H22ClF3N2.ClH/c1-11(2)10-14(22-8-6-21-7-9-22)15-12(16(18,19)20)4-3-5-13(15)17;/h3-5,11,14,21H,6-10H2,1-2H3;1H/t14-;/m0./s1 |
| InChIKey | KFWBSNJMEDOHFX-UQKRIMTDSA-N |
| XLogP | 4.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |