C13H16ClF3N2O — CID 171174513
(2R)-2-[2-chloro-6-(trifluoromethyl)phenyl]-2-piperazin-1-ylethanol (PubChem CID 171174513) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is (2R)-2-[2-chloro-6-(trifluoromethyl)phenyl]-2-piperazin-1-ylethanol.
| Compound Name | (2R)-2-[2-chloro-6-(trifluoromethyl)phenyl]-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 171174513 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (2R)-2-[2-chloro-6-(trifluoromethyl)phenyl]-2-piperazin-1-ylethanol |
| SMILES | OC[C@@H](c1c(Cl)cccc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H16ClF3N2O/c14-10-3-1-2-9(13(15,16)17)12(10)11(8-20)19-6-4-18-5-7-19/h1-3,11,18,20H,4-8H2/t11-/m0/s1 |
| InChIKey | ZADUERPDKJGEDV-NSHDSACASA-N |
| XLogP | 2.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |