C9H6ClF4NO2 — CID 66513387
(2S)-2-amino-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]acetic acid (PubChem CID 66513387) has the molecular formula C9H6ClF4NO2 and a molecular weight of 271.60 g/mol. Its IUPAC name is (2S)-2-amino-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | (2S)-2-amino-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 66513387 |
| Molecular Formula | C9H6ClF4NO2 |
| Molecular Weight | 271.60 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | (2S)-2-amino-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]acetic acid |
| SMILES | N[C@H](C(=O)O)c1c(C(F)(F)F)ccc(Cl)c1F |
| InChI | InChI=1S/C9H6ClF4NO2/c10-4-2-1-3(9(12,13)14)5(6(4)11)7(15)8(16)17/h1-2,7H,15H2,(H,16,17)/t7-/m0/s1 |
| InChIKey | CRAZVBFUONIKHE-ZETCQYMHSA-N |
| XLogP | 2.58 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |