C11H12F3NO4 — CID 117447457
2-amino-2-[2,3-dimethoxy-6-(trifluoromethyl)phenyl]acetic acid (PubChem CID 117447457) has the molecular formula C11H12F3NO4 and a molecular weight of 279.21 g/mol. Its IUPAC name is 2-amino-2-[2,3-dimethoxy-6-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-amino-2-[2,3-dimethoxy-6-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 117447457 |
| Molecular Formula | C11H12F3NO4 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-amino-2-[2,3-dimethoxy-6-(trifluoromethyl)phenyl]acetic acid |
| SMILES | COc1ccc(C(F)(F)F)c(C(N)C(=O)O)c1OC |
| InChI | InChI=1S/C11H12F3NO4/c1-18-6-4-3-5(11(12,13)14)7(9(6)19-2)8(15)10(16)17/h3-4,8H,15H2,1-2H3,(H,16,17) |
| InChIKey | NASSNOGRCHLJMN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |