C13H15F3O4 — CID 117471835
4-[2,3-dimethoxy-6-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 117471835) has the molecular formula C13H15F3O4 and a molecular weight of 292.25 g/mol. Its IUPAC name is 4-[2,3-dimethoxy-6-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 4-[2,3-dimethoxy-6-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117471835 |
| Molecular Formula | C13H15F3O4 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-[2,3-dimethoxy-6-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | COc1ccc(C(F)(F)F)c(CCCC(=O)O)c1OC |
| InChI | InChI=1S/C13H15F3O4/c1-19-10-7-6-9(13(14,15)16)8(12(10)20-2)4-3-5-11(17)18/h6-7H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | LCHKNWIHBNGARO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |