C12H12F6 — CID 20823616
2-butan-2-yl-1,3-bis(trifluoromethyl)benzene (PubChem CID 20823616) has the molecular formula C12H12F6 and a molecular weight of 270.22 g/mol. Its IUPAC name is 2-butan-2-yl-1,3-bis(trifluoromethyl)benzene.
| Compound Name | 2-butan-2-yl-1,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 20823616 |
| Molecular Formula | C12H12F6 |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-butan-2-yl-1,3-bis(trifluoromethyl)benzene |
| SMILES | CCC(C)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F6/c1-3-7(2)10-8(11(13,14)15)5-4-6-9(10)12(16,17)18/h4-7H,3H2,1-2H3 |
| InChIKey | ZQLVYNQAYBILEB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |