C17H24ClNO — CID 11609028
(3R)-N-methyl-3-naphthalen-2-yloxyhexan-1-amine;hydrochloride (PubChem CID 11609028) has the molecular formula C17H24ClNO and a molecular weight of 293.84 g/mol. Its IUPAC name is (3R)-N-methyl-3-naphthalen-2-yloxyhexan-1-amine;hydrochloride.
| Compound Name | (3R)-N-methyl-3-naphthalen-2-yloxyhexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 11609028 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (3R)-N-methyl-3-naphthalen-2-yloxyhexan-1-amine;hydrochloride |
| SMILES | CCC[C@H](CCNC)Oc1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C17H23NO.ClH/c1-3-6-16(11-12-18-2)19-17-10-9-14-7-4-5-8-15(14)13-17;/h4-5,7-10,13,16,18H,3,6,11-12H2,1-2H3;1H/t16-;/m1./s1 |
| InChIKey | BDYNVWLBHAGEOF-PKLMIRHRSA-N |
| XLogP | 4.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |