C14H23NO — CID 83044503
2-(2,3-dimethylphenoxy)-N-methylpentan-1-amine (PubChem CID 83044503) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-methylpentan-1-amine.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 83044503 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-methylpentan-1-amine |
| SMILES | CCCC(CNC)Oc1cccc(C)c1C |
| InChI | InChI=1S/C14H23NO/c1-5-7-13(10-15-4)16-14-9-6-8-11(2)12(14)3/h6,8-9,13,15H,5,7,10H2,1-4H3 |
| InChIKey | LBMWBKRRUVSKLS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |