C15H25NO — CID 83045581
2-(2-methylphenoxy)-N-propan-2-ylpentan-1-amine (PubChem CID 83045581) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-(2-methylphenoxy)-N-propan-2-ylpentan-1-amine.
| Compound Name | 2-(2-methylphenoxy)-N-propan-2-ylpentan-1-amine |
|---|---|
| PubChem CID | 83045581 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-(2-methylphenoxy)-N-propan-2-ylpentan-1-amine |
| SMILES | CCCC(CNC(C)C)Oc1ccccc1C |
| InChI | InChI=1S/C15H25NO/c1-5-8-14(11-16-12(2)3)17-15-10-7-6-9-13(15)4/h6-7,9-10,12,14,16H,5,8,11H2,1-4H3 |
| InChIKey | KHGKXMWURQIWDN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |