C17H18Cl2F3NO — CID 22489955
3-[5-chloro-2-(trifluoromethyl)phenoxy]-N-methyl-3-phenylpropan-1-amine;hydrochloride (PubChem CID 22489955) has the molecular formula C17H18Cl2F3NO and a molecular weight of 380.24 g/mol. Its IUPAC name is 3-[5-chloro-2-(trifluoromethyl)phenoxy]-N-methyl-3-phenylpropan-1-amine;hydrochloride.
| Compound Name | 3-[5-chloro-2-(trifluoromethyl)phenoxy]-N-methyl-3-phenylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 22489955 |
| Molecular Formula | C17H18Cl2F3NO |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3-[5-chloro-2-(trifluoromethyl)phenoxy]-N-methyl-3-phenylpropan-1-amine;hydrochloride |
| SMILES | CNCCC(Oc1cc(Cl)ccc1C(F)(F)F)c1ccccc1.Cl |
| InChI | InChI=1S/C17H17ClF3NO.ClH/c1-22-10-9-15(12-5-3-2-4-6-12)23-16-11-13(18)7-8-14(16)17(19,20)21;/h2-8,11,15,22H,9-10H2,1H3;1H |
| InChIKey | FEDGGTZDOWGCSH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |