C17H21ClINO — CID 45262226
(3R)-3-(2-iodo-4-methylphenoxy)-N-methyl-3-phenylpropan-1-amine;hydrochloride (PubChem CID 45262226) has the molecular formula C17H21ClINO and a molecular weight of 417.72 g/mol. Its IUPAC name is (3R)-3-(2-iodo-4-methylphenoxy)-N-methyl-3-phenylpropan-1-amine;hydrochloride.
| Compound Name | (3R)-3-(2-iodo-4-methylphenoxy)-N-methyl-3-phenylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 45262226 |
| Molecular Formula | C17H21ClINO |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | (3R)-3-(2-iodo-4-methylphenoxy)-N-methyl-3-phenylpropan-1-amine;hydrochloride |
| SMILES | CNCC[C@@H](Oc1ccc(C)cc1I)c1ccccc1.Cl |
| InChI | InChI=1S/C17H20INO.ClH/c1-13-8-9-17(15(18)12-13)20-16(10-11-19-2)14-6-4-3-5-7-14;/h3-9,12,16,19H,10-11H2,1-2H3;1H/t16-;/m1./s1 |
| InChIKey | FHOMBXYAAKFJNN-PKLMIRHRSA-N |
| XLogP | 4.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|