C17H22ClNO — CID 146156685
3-(2-methylphenoxy)-3-phenyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride (PubChem CID 146156685) has the molecular formula C17H22ClNO and a molecular weight of 294.84 g/mol. Its IUPAC name is 3-(2-methylphenoxy)-3-phenyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride.
| Compound Name | 3-(2-methylphenoxy)-3-phenyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 146156685 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 294.84 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-(2-methylphenoxy)-3-phenyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])NCCC(Oc1ccccc1C)c1ccccc1 |
| InChI | InChI=1S/C17H21NO.ClH/c1-14-8-6-7-11-16(14)19-17(12-13-18-2)15-9-4-3-5-10-15;/h3-11,17-18H,12-13H2,1-2H3;1H/i2D3; |
| InChIKey | LUCXVPAZUDVVBT-MUTAZJQDSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |