About methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride
methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride (PubChem CID 175100899) has the molecular formula C17H24ClNO
and a molecular weight of 293.84 g/mol. Its IUPAC name is methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride.
Molecular Properties
| Compound Name | methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride |
| PubChem CID | 175100899 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride |
| SMILES | CCC(Oc1ccccc1C)c1ccccc1.CN.Cl |
| InChI | InChI=1S/C16H18O.CH5N.ClH/c1-3-15(14-10-5-4-6-11-14)17-16-12-8-7-9-13(16)2;1-2;/h4-12,15H,3H2,1-2H3;2H2,1H3;1H |
| InChIKey | XPQWDWVCGBORRI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride?
The IUPAC name of methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride (CID 175100899) is methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride.
What is the SMILES notation for methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride?
The canonical SMILES for methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride is CCC(Oc1ccccc1C)c1ccccc1.CN.Cl.
What is the InChIKey of methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride?
The InChIKey is XPQWDWVCGBORRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O.CH5N.ClH/c1-3-15(14-10-5-4-6-11-14)17-16-12-8-7-9-13(16)2;1-2;/h4-12,15H,3H2,1-2H3;2H2,1H3;1H.
What are the key properties of methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride?
methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride has a molecular weight of 293.84 g/mol, XLogP of 4.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-methyl-2-(1-phenylpropoxy)benzene;hydrochloride is sourced from PubChem (CID 175100899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).