C19H23NO5 — CID 11609891
N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine;oxalic acid (PubChem CID 11609891) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine;oxalic acid.
| Compound Name | N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 11609891 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine;oxalic acid |
| SMILES | CNCCC(Oc1ccccc1C)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H21NO.C2H2O4/c1-14-8-6-7-11-16(14)19-17(12-13-18-2)15-9-4-3-5-10-15;3-1(4)2(5)6/h3-11,17-18H,12-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | ACTXRVFFPMIYAW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|