C19H25NOS — CID 11175584
(3R)-N-methyl-3-phenyl-3-(2-propylsulfanylphenoxy)propan-1-amine (PubChem CID 11175584) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is (3R)-N-methyl-3-phenyl-3-(2-propylsulfanylphenoxy)propan-1-amine.
| Compound Name | (3R)-N-methyl-3-phenyl-3-(2-propylsulfanylphenoxy)propan-1-amine |
|---|---|
| PubChem CID | 11175584 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (3R)-N-methyl-3-phenyl-3-(2-propylsulfanylphenoxy)propan-1-amine |
| SMILES | CCCSc1ccccc1O[C@H](CCNC)c1ccccc1 |
| InChI | InChI=1S/C19H25NOS/c1-3-15-22-19-12-8-7-11-18(19)21-17(13-14-20-2)16-9-5-4-6-10-16/h4-12,17,20H,3,13-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | JCLUPARNFNPCKE-QGZVFWFLSA-N |
| XLogP | 4.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |