C15H17IN2O — CID 25125568
3-[(2-iodo-3-pyridinyl)oxy]-N-methyl-3-phenylpropan-1-amine (PubChem CID 25125568) has the molecular formula C15H17IN2O and a molecular weight of 368.22 g/mol. Its IUPAC name is 3-[(2-iodo-3-pyridinyl)oxy]-N-methyl-3-phenylpropan-1-amine.
| Compound Name | 3-[(2-iodo-3-pyridinyl)oxy]-N-methyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 25125568 |
| Molecular Formula | C15H17IN2O |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 3-[(2-iodo-3-pyridinyl)oxy]-N-methyl-3-phenylpropan-1-amine |
| SMILES | CNCCC(Oc1cccnc1I)c1ccccc1 |
| InChI | InChI=1S/C15H17IN2O/c1-17-11-9-13(12-6-3-2-4-7-12)19-14-8-5-10-18-15(14)16/h2-8,10,13,17H,9,11H2,1H3 |
| InChIKey | QFAIJDNPCCNTBY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|