C18H24N2O2 — CID 122581769
(3R)-3-[(2-ethoxy-3-pyridinyl)oxy]-N-ethyl-3-phenylpropan-1-amine (PubChem CID 122581769) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3R)-3-[(2-ethoxy-3-pyridinyl)oxy]-N-ethyl-3-phenylpropan-1-amine.
| Compound Name | (3R)-3-[(2-ethoxy-3-pyridinyl)oxy]-N-ethyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 122581769 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (3R)-3-[(2-ethoxy-3-pyridinyl)oxy]-N-ethyl-3-phenylpropan-1-amine |
| SMILES | CCNCC[C@@H](Oc1cccnc1OCC)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O2/c1-3-19-14-12-16(15-9-6-5-7-10-15)22-17-11-8-13-20-18(17)21-4-2/h5-11,13,16,19H,3-4,12,14H2,1-2H3/t16-/m1/s1 |
| InChIKey | FDUKXVZUSDZNAD-MRXNPFEDSA-N |
| XLogP | 3.60 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|