C18H22BrNO3 — CID 67845393
3-(2-bromophenoxy)-N-ethyl-3-phenylpropan-1-amine;formic acid (PubChem CID 67845393) has the molecular formula C18H22BrNO3 and a molecular weight of 380.28 g/mol. Its IUPAC name is 3-(2-bromophenoxy)-N-ethyl-3-phenylpropan-1-amine;formic acid.
| Compound Name | 3-(2-bromophenoxy)-N-ethyl-3-phenylpropan-1-amine;formic acid |
|---|---|
| PubChem CID | 67845393 |
| Molecular Formula | C18H22BrNO3 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-(2-bromophenoxy)-N-ethyl-3-phenylpropan-1-amine;formic acid |
| SMILES | CCNCCC(Oc1ccccc1Br)c1ccccc1.O=CO |
| InChI | InChI=1S/C17H20BrNO.CH2O2/c1-2-19-13-12-16(14-8-4-3-5-9-14)20-17-11-7-6-10-15(17)18;2-1-3/h3-11,16,19H,2,12-13H2,1H3;1H,(H,2,3) |
| InChIKey | YTNRWVYBGKZMMU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|