C18H18FNOS — CID 58630752
(3R)-3-[(5-fluoro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine (PubChem CID 58630752) has the molecular formula C18H18FNOS and a molecular weight of 315.41 g/mol. Its IUPAC name is (3R)-3-[(5-fluoro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine.
| Compound Name | (3R)-3-[(5-fluoro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 58630752 |
| Molecular Formula | C18H18FNOS |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (3R)-3-[(5-fluoro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine |
| SMILES | CNCC[C@@H](Oc1cc(F)cc2ccsc12)c1ccccc1 |
| InChI | InChI=1S/C18H18FNOS/c1-20-9-7-16(13-5-3-2-4-6-13)21-17-12-15(19)11-14-8-10-22-18(14)17/h2-6,8,10-12,16,20H,7,9H2,1H3/t16-/m1/s1 |
| InChIKey | BRKOWVGTLLJGTL-MRXNPFEDSA-N |
| XLogP | 4.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |