C17H18F3NO — CID 138402735
N-deuterio-N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine (PubChem CID 138402735) has the molecular formula C17H18F3NO and a molecular weight of 310.34 g/mol. Its IUPAC name is N-deuterio-N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine.
| Compound Name | N-deuterio-N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 138402735 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-deuterio-N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
| SMILES | [2H]N(C)CCC(Oc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H18F3NO/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20/h2-10,16,21H,11-12H2,1H3/i/hD |
| InChIKey | RTHCYVBBDHJXIQ-DYCDLGHISA-N |
| XLogP | 4.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |