C16H15ClF3NO — CID 54285023
N-chloro-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine (PubChem CID 54285023) has the molecular formula C16H15ClF3NO and a molecular weight of 329.75 g/mol. Its IUPAC name is N-chloro-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine.
| Compound Name | N-chloro-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 54285023 |
| Molecular Formula | C16H15ClF3NO |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-chloro-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
| SMILES | FC(F)(F)c1ccc(OC(CCNCl)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15ClF3NO/c17-21-11-10-15(12-4-2-1-3-5-12)22-14-8-6-13(7-9-14)16(18,19)20/h1-9,15,21H,10-11H2 |
| InChIKey | RTMYRSFHYZXYLO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|