C25H25F3N2O4 — CID 171777098
N-hydroxy-4-[2-[[(3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]ethoxy]benzamide (PubChem CID 171777098) has the molecular formula C25H25F3N2O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is N-hydroxy-4-[2-[[(3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]ethoxy]benzamide.
| Compound Name | N-hydroxy-4-[2-[[(3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 171777098 |
| Molecular Formula | C25H25F3N2O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-hydroxy-4-[2-[[(3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]ethoxy]benzamide |
| SMILES | O=C(NO)c1ccc(OCCNCC[C@@H](Oc2ccc(C(F)(F)F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25F3N2O4/c26-25(27,28)20-8-12-22(13-9-20)34-23(18-4-2-1-3-5-18)14-15-29-16-17-33-21-10-6-19(7-11-21)24(31)30-32/h1-13,23,29,32H,14-17H2,(H,30,31)/t23-/m1/s1 |
| InChIKey | XBXWAHFWUPHVOB-HSZRJFAPSA-N |
| XLogP | 5.00 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|