C19H21F3N2O3 — CID 175586540
N-hydroxy-3-[[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]propanamide (PubChem CID 175586540) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is N-hydroxy-3-[[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]propanamide.
| Compound Name | N-hydroxy-3-[[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]propanamide |
|---|---|
| PubChem CID | 175586540 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-hydroxy-3-[[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]propanamide |
| SMILES | O=C(CCNCCC(Oc1ccc(C(F)(F)F)cc1)c1ccccc1)NO |
| InChI | InChI=1S/C19H21F3N2O3/c20-19(21,22)15-6-8-16(9-7-15)27-17(14-4-2-1-3-5-14)10-12-23-13-11-18(25)24-26/h1-9,17,23,26H,10-13H2,(H,24,25) |
| InChIKey | QHLZGWPNRKMRMA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|