C15H22Cl2N2O2 — CID 69453911
3-(2,4-dichlorophenoxy)-N-methyl-4-morpholin-4-ylbutan-1-amine (PubChem CID 69453911) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 3-(2,4-dichlorophenoxy)-N-methyl-4-morpholin-4-ylbutan-1-amine.
| Compound Name | 3-(2,4-dichlorophenoxy)-N-methyl-4-morpholin-4-ylbutan-1-amine |
|---|---|
| PubChem CID | 69453911 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 3-(2,4-dichlorophenoxy)-N-methyl-4-morpholin-4-ylbutan-1-amine |
| SMILES | CNCCC(CN1CCOCC1)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H22Cl2N2O2/c1-18-5-4-13(11-19-6-8-20-9-7-19)21-15-3-2-12(16)10-14(15)17/h2-3,10,13,18H,4-9,11H2,1H3 |
| InChIKey | IFWNHOHPEXMMIW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |