C34H46Cl4N4O8 — CID 87840133
bis[[(3R)-3-(2,4-dichlorophenoxy)-4-morpholin-4-ylbutyl]-methylamino] butanedioate (PubChem CID 87840133) has the molecular formula C34H46Cl4N4O8 and a molecular weight of 780.57 g/mol. Its IUPAC name is bis[[(3R)-3-(2,4-dichlorophenoxy)-4-morpholin-4-ylbutyl]-methylamino] butanedioate.
| Compound Name | bis[[(3R)-3-(2,4-dichlorophenoxy)-4-morpholin-4-ylbutyl]-methylamino] butanedioate |
|---|---|
| PubChem CID | 87840133 |
| Molecular Formula | C34H46Cl4N4O8 |
| Molecular Weight | 780.57 g/mol |
| Exact Mass | 778.21 |
| IUPAC Name | bis[[(3R)-3-(2,4-dichlorophenoxy)-4-morpholin-4-ylbutyl]-methylamino] butanedioate |
| SMILES | CN(CC[C@H](CN1CCOCC1)Oc1ccc(Cl)cc1Cl)OC(=O)CCC(=O)ON(C)CC[C@H](CN1CCOCC1)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C34H46Cl4N4O8/c1-39(11-9-27(23-41-13-17-45-18-14-41)47-31-5-3-25(35)21-29(31)37)49-33(43)7-8-34(44)50-40(2)12-10-28(24-42-15-19-46-20-16-42)48-32-6-4-26(36)22-30(32)38/h3-6,21-22,27-28H,7-20,23-24H2,1-2H3/t27-,28-/m1/s1 |
| InChIKey | LVFUGFOUSRBFQT-VSGBNLITSA-N |
| XLogP | 5.50 |
| TPSA | 102.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|