C20H19Cl4NO6 — CID 175933797
4-[[3-carboxy-3-(2,4-dichlorophenoxy)propyl]amino]-2-(2,4-dichlorophenoxy)butanoic acid (PubChem CID 175933797) has the molecular formula C20H19Cl4NO6 and a molecular weight of 511.19 g/mol. Its IUPAC name is 4-[[3-carboxy-3-(2,4-dichlorophenoxy)propyl]amino]-2-(2,4-dichlorophenoxy)butanoic acid.
| Compound Name | 4-[[3-carboxy-3-(2,4-dichlorophenoxy)propyl]amino]-2-(2,4-dichlorophenoxy)butanoic acid |
|---|---|
| PubChem CID | 175933797 |
| Molecular Formula | C20H19Cl4NO6 |
| Molecular Weight | 511.19 g/mol |
| Exact Mass | 509.00 |
| IUPAC Name | 4-[[3-carboxy-3-(2,4-dichlorophenoxy)propyl]amino]-2-(2,4-dichlorophenoxy)butanoic acid |
| SMILES | O=C(O)C(CCNCCC(Oc1ccc(Cl)cc1Cl)C(=O)O)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H19Cl4NO6/c21-11-1-3-15(13(23)9-11)30-17(19(26)27)5-7-25-8-6-18(20(28)29)31-16-4-2-12(22)10-14(16)24/h1-4,9-10,17-18,25H,5-8H2,(H,26,27)(H,28,29) |
| InChIKey | RNZWKRBHVZOFFU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.19 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|