C15H22ClNO3 — CID 83037948
2-[2-chloro-4-(propylaminomethyl)phenoxy]pentanoic acid (PubChem CID 83037948) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-[2-chloro-4-(propylaminomethyl)phenoxy]pentanoic acid.
| Compound Name | 2-[2-chloro-4-(propylaminomethyl)phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 83037948 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[2-chloro-4-(propylaminomethyl)phenoxy]pentanoic acid |
| SMILES | CCCNCc1ccc(OC(CCC)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C15H22ClNO3/c1-3-5-14(15(18)19)20-13-7-6-11(9-12(13)16)10-17-8-4-2/h6-7,9,14,17H,3-5,8,10H2,1-2H3,(H,18,19) |
| InChIKey | FUFIGUAODSPRTJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|