C12H12Cl4O3 — CID 57323822
4,6-dichloro-2-(2,4-dichlorophenoxy)hexanoic acid (PubChem CID 57323822) has the molecular formula C12H12Cl4O3 and a molecular weight of 346.04 g/mol. Its IUPAC name is 4,6-dichloro-2-(2,4-dichlorophenoxy)hexanoic acid.
| Compound Name | 4,6-dichloro-2-(2,4-dichlorophenoxy)hexanoic acid |
|---|---|
| PubChem CID | 57323822 |
| Molecular Formula | C12H12Cl4O3 |
| Molecular Weight | 346.04 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 4,6-dichloro-2-(2,4-dichlorophenoxy)hexanoic acid |
| SMILES | O=C(O)C(CC(Cl)CCCl)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl4O3/c13-4-3-8(15)6-11(12(17)18)19-10-2-1-7(14)5-9(10)16/h1-2,5,8,11H,3-4,6H2,(H,17,18) |
| InChIKey | YRHPAVHUBLGBCG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.04 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|