C12H13Cl3O2 — CID 15070677
1-chloro-1-(2,4-dichlorophenoxy)-3,3-dimethylbutan-2-one (PubChem CID 15070677) has the molecular formula C12H13Cl3O2 and a molecular weight of 295.59 g/mol. Its IUPAC name is 1-chloro-1-(2,4-dichlorophenoxy)-3,3-dimethylbutan-2-one.
| Compound Name | 1-chloro-1-(2,4-dichlorophenoxy)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 15070677 |
| Molecular Formula | C12H13Cl3O2 |
| Molecular Weight | 295.59 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 1-chloro-1-(2,4-dichlorophenoxy)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)C(Cl)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl3O2/c1-12(2,3)10(16)11(15)17-9-5-4-7(13)6-8(9)14/h4-6,11H,1-3H3 |
| InChIKey | GYKGISNCTRWFQB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|