C13H18Cl2N2OS — CID 8775084
2-(2,4-dichlorophenoxy)ethyl N'-[(2S)-butan-2-yl]carbamimidothioate (PubChem CID 8775084) has the molecular formula C13H18Cl2N2OS and a molecular weight of 321.27 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl N'-[(2S)-butan-2-yl]carbamimidothioate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl N'-[(2S)-butan-2-yl]carbamimidothioate |
|---|---|
| PubChem CID | 8775084 |
| Molecular Formula | C13H18Cl2N2OS |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl N'-[(2S)-butan-2-yl]carbamimidothioate |
| SMILES | CC[C@H](C)/N=C(\N)SCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N2OS/c1-3-9(2)17-13(16)19-7-6-18-12-5-4-10(14)8-11(12)15/h4-5,8-9H,3,6-7H2,1-2H3,(H2,16,17)/t9-/m0/s1 |
| InChIKey | NGERSMORMPDCJU-VIFPVBQESA-N |
| XLogP | 4.22 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|