C17H18Cl2N2OS — CID 8776664
2-(2,4-dichlorophenoxy)ethyl N'-(3,4-dimethylphenyl)carbamimidothioate (PubChem CID 8776664) has the molecular formula C17H18Cl2N2OS and a molecular weight of 369.32 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl N'-(3,4-dimethylphenyl)carbamimidothioate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl N'-(3,4-dimethylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 8776664 |
| Molecular Formula | C17H18Cl2N2OS |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl N'-(3,4-dimethylphenyl)carbamimidothioate |
| SMILES | Cc1ccc(/N=C(/N)SCCOc2ccc(Cl)cc2Cl)cc1C |
| InChI | InChI=1S/C17H18Cl2N2OS/c1-11-3-5-14(9-12(11)2)21-17(20)23-8-7-22-16-6-4-13(18)10-15(16)19/h3-6,9-10H,7-8H2,1-2H3,(H2,20,21) |
| InChIKey | FQGLIZMSERLZEH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|