C16H17ClN2OS — CID 8776546
2-(4-chlorophenoxy)ethyl N'-(3-methylphenyl)carbamimidothioate (PubChem CID 8776546) has the molecular formula C16H17ClN2OS and a molecular weight of 320.85 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl N'-(3-methylphenyl)carbamimidothioate.
| Compound Name | 2-(4-chlorophenoxy)ethyl N'-(3-methylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 8776546 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl N'-(3-methylphenyl)carbamimidothioate |
| SMILES | Cc1cccc(/N=C(/N)SCCOc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H17ClN2OS/c1-12-3-2-4-14(11-12)19-16(18)21-10-9-20-15-7-5-13(17)6-8-15/h2-8,11H,9-10H2,1H3,(H2,18,19) |
| InChIKey | BCJZVAJXNYQSMQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|